C9H11F3N2OS — CID 150817803
(2R)-2-[(2,2,2-trifluoro-1-thiophen-2-ylethyl)amino]propanamide (PubChem CID 150817803) has the molecular formula C9H11F3N2OS and a molecular weight of 252.26 g/mol. Its IUPAC name is (2R)-2-[(2,2,2-trifluoro-1-thiophen-2-ylethyl)amino]propanamide.
| Compound Name | (2R)-2-[(2,2,2-trifluoro-1-thiophen-2-ylethyl)amino]propanamide |
|---|---|
| PubChem CID | 150817803 |
| Molecular Formula | C9H11F3N2OS |
| Molecular Weight | 252.26 g/mol |
| Exact Mass | 252.05 |
| IUPAC Name | (2R)-2-[(2,2,2-trifluoro-1-thiophen-2-ylethyl)amino]propanamide |
| SMILES | C[C@@H](NC(c1cccs1)C(F)(F)F)C(N)=O |
| InChI | InChI=1S/C9H11F3N2OS/c1-5(8(13)15)14-7(9(10,11)12)6-3-2-4-16-6/h2-5,7,14H,1H3,(H2,13,15)/t5-,7?/m1/s1 |
| InChIKey | KJGLHKYNAPYLFE-FOUAAFFMSA-N |
| XLogP | 1.81 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.26 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |