C40H58O6 — CID 150828913
2,3,4-triethoxy-1-[1-(2,3,4-triethoxy-1H-inden-1-yl)decyl]-1H-indene (PubChem CID 150828913) has the molecular formula C40H58O6 and a molecular weight of 634.90 g/mol. Its IUPAC name is 2,3,4-triethoxy-1-[1-(2,3,4-triethoxy-1H-inden-1-yl)decyl]-1H-indene.
| Compound Name | 2,3,4-triethoxy-1-[1-(2,3,4-triethoxy-1H-inden-1-yl)decyl]-1H-indene |
|---|---|
| PubChem CID | 150828913 |
| Molecular Formula | C40H58O6 |
| Molecular Weight | 634.90 g/mol |
| Exact Mass | 634.42 |
| IUPAC Name | 2,3,4-triethoxy-1-[1-(2,3,4-triethoxy-1H-inden-1-yl)decyl]-1H-indene |
| SMILES | CCCCCCCCCC(C1C(OCC)=C(OCC)c2c(OCC)cccc21)C1C(OCC)=C(OCC)c2c(OCC)cccc21 |
| InChI | InChI=1S/C40H58O6/c1-8-15-16-17-18-19-20-23-28(33-29-24-21-26-31(41-9-2)35(29)39(45-13-6)37(33)43-11-4)34-30-25-22-27-32(42-10-3)36(30)40(46-14-7)38(34)44-12-5/h21-22,24-28,33-34H,8-20,23H2,1-7H3 |
| InChIKey | KLNJVOYDKNMRPG-UHFFFAOYSA-N |
| XLogP | 10.62 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.90 |
| LogP ≤ 5 | 10.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|