C24H36O5 — CID 150883626
2-[1-[3-(2,3,4-triethoxy-1H-inden-1-yl)propoxy]butan-2-yl]oxirane (PubChem CID 150883626) has the molecular formula C24H36O5 and a molecular weight of 404.55 g/mol. Its IUPAC name is 2-[1-[3-(2,3,4-triethoxy-1H-inden-1-yl)propoxy]butan-2-yl]oxirane.
| Compound Name | 2-[1-[3-(2,3,4-triethoxy-1H-inden-1-yl)propoxy]butan-2-yl]oxirane |
|---|---|
| PubChem CID | 150883626 |
| Molecular Formula | C24H36O5 |
| Molecular Weight | 404.55 g/mol |
| Exact Mass | 404.26 |
| IUPAC Name | 2-[1-[3-(2,3,4-triethoxy-1H-inden-1-yl)propoxy]butan-2-yl]oxirane |
| SMILES | CCOC1=C(OCC)C(CCCOCC(CC)C2CO2)c2cccc(OCC)c21 |
| InChI | InChI=1S/C24H36O5/c1-5-17(21-16-29-21)15-25-14-10-12-19-18-11-9-13-20(26-6-2)22(18)24(28-8-4)23(19)27-7-3/h9,11,13,17,19,21H,5-8,10,12,14-16H2,1-4H3 |
| InChIKey | KWNXKZNHTZDITR-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 49.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.55 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|