C31H40O5 — CID 150327416
1-[2-[2-(diethoxymethyl)-1H-inden-1-yl]ethyl]-2,3,4-triethoxy-1H-indene (PubChem CID 150327416) has the molecular formula C31H40O5 and a molecular weight of 492.66 g/mol. Its IUPAC name is 1-[2-[2-(diethoxymethyl)-1H-inden-1-yl]ethyl]-2,3,4-triethoxy-1H-indene.
| Compound Name | 1-[2-[2-(diethoxymethyl)-1H-inden-1-yl]ethyl]-2,3,4-triethoxy-1H-indene |
|---|---|
| PubChem CID | 150327416 |
| Molecular Formula | C31H40O5 |
| Molecular Weight | 492.66 g/mol |
| Exact Mass | 492.29 |
| IUPAC Name | 1-[2-[2-(diethoxymethyl)-1H-inden-1-yl]ethyl]-2,3,4-triethoxy-1H-indene |
| SMILES | CCOC1=C(OCC)C(CCC2C(C(OCC)OCC)=Cc3ccccc32)c2cccc(OCC)c21 |
| InChI | InChI=1S/C31H40O5/c1-6-32-27-17-13-16-24-25(29(33-7-2)30(28(24)27)34-8-3)19-18-23-22-15-12-11-14-21(22)20-26(23)31(35-9-4)36-10-5/h11-17,20,23,25,31H,6-10,18-19H2,1-5H3 |
| InChIKey | GOYASNSKBLMBIE-UHFFFAOYSA-N |
| XLogP | 7.28 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.66 |
| LogP ≤ 5 | 7.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|