C18H17F6N4O7P — CID 150836565
3,3-bis[2-nitro-4-(trifluoromethyl)anilino]butan-2-ylphosphonic acid (PubChem CID 150836565) has the molecular formula C18H17F6N4O7P and a molecular weight of 546.32 g/mol. Its IUPAC name is 3,3-bis[2-nitro-4-(trifluoromethyl)anilino]butan-2-ylphosphonic acid.
| Compound Name | 3,3-bis[2-nitro-4-(trifluoromethyl)anilino]butan-2-ylphosphonic acid |
|---|---|
| PubChem CID | 150836565 |
| Molecular Formula | C18H17F6N4O7P |
| Molecular Weight | 546.32 g/mol |
| Exact Mass | 546.07 |
| IUPAC Name | 3,3-bis[2-nitro-4-(trifluoromethyl)anilino]butan-2-ylphosphonic acid |
| SMILES | CC(C(C)(Nc1ccc(C(F)(F)F)cc1[N+](=O)[O-])Nc1ccc(C(F)(F)F)cc1[N+](=O)[O-])P(=O)(O)O |
| InChI | InChI=1S/C18H17F6N4O7P/c1-9(36(33,34)35)16(2,25-12-5-3-10(17(19,20)21)7-14(12)27(29)30)26-13-6-4-11(18(22,23)24)8-15(13)28(31)32/h3-9,25-26H,1-2H3,(H2,33,34,35) |
| InChIKey | KNCGVCOGDUHMFN-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 167.87 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.32 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|