C24H24F6N4O10P2 — CID 160631608
[[2-nitro-4-(trifluoromethyl)anilino]-phenylmethyl]phosphonic acid;2-[2-nitro-4-(trifluoromethyl)anilino]propan-2-ylphosphonic acid (PubChem CID 160631608) has the molecular formula C24H24F6N4O10P2 and a molecular weight of 704.41 g/mol. Its IUPAC name is [[2-nitro-4-(trifluoromethyl)anilino]-phenylmethyl]phosphonic acid;2-[2-nitro-4-(trifluoromethyl)anilino]propan-2-ylphosphonic acid.
| Compound Name | [[2-nitro-4-(trifluoromethyl)anilino]-phenylmethyl]phosphonic acid;2-[2-nitro-4-(trifluoromethyl)anilino]propan-2-ylphosphonic acid |
|---|---|
| PubChem CID | 160631608 |
| Molecular Formula | C24H24F6N4O10P2 |
| Molecular Weight | 704.41 g/mol |
| Exact Mass | 704.09 |
| IUPAC Name | [[2-nitro-4-(trifluoromethyl)anilino]-phenylmethyl]phosphonic acid;2-[2-nitro-4-(trifluoromethyl)anilino]propan-2-ylphosphonic acid |
| SMILES | CC(C)(Nc1ccc(C(F)(F)F)cc1[N+](=O)[O-])P(=O)(O)O.O=[N+]([O-])c1cc(C(F)(F)F)ccc1NC(c1ccccc1)P(=O)(O)O |
| InChI | InChI=1S/C14H12F3N2O5P.C10H12F3N2O5P/c15-14(16,17)10-6-7-11(12(8-10)19(20)21)18-13(25(22,23)24)9-4-2-1-3-5-9;1-9(2,21(18,19)20)14-7-4-3-6(10(11,12)13)5-8(7)15(16)17/h1-8,13,18H,(H2,22,23,24);3-5,14H,1-2H3,(H2,18,19,20) |
| InChIKey | RHZLGELREGSRSF-UHFFFAOYSA-N |
| XLogP | 6.84 |
| TPSA | 225.40 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 46 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 704.41 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|