C12H9F3N2O5 — CID 39116534
(Z)-3-methyl-4-[2-nitro-4-(trifluoromethyl)anilino]-4-oxobut-2-enoic acid (PubChem CID 39116534) has the molecular formula C12H9F3N2O5 and a molecular weight of 318.21 g/mol. Its IUPAC name is (Z)-3-methyl-4-[2-nitro-4-(trifluoromethyl)anilino]-4-oxobut-2-enoic acid.
| Compound Name | (Z)-3-methyl-4-[2-nitro-4-(trifluoromethyl)anilino]-4-oxobut-2-enoic acid |
|---|---|
| PubChem CID | 39116534 |
| Molecular Formula | C12H9F3N2O5 |
| Molecular Weight | 318.21 g/mol |
| Exact Mass | 318.05 |
| IUPAC Name | (Z)-3-methyl-4-[2-nitro-4-(trifluoromethyl)anilino]-4-oxobut-2-enoic acid |
| SMILES | C/C(=C/C(=O)O)C(=O)Nc1ccc(C(F)(F)F)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C12H9F3N2O5/c1-6(4-10(18)19)11(20)16-8-3-2-7(12(13,14)15)5-9(8)17(21)22/h2-5H,1H3,(H,16,20)(H,18,19)/b6-4- |
| InChIKey | DOGRSBNCFRAUBA-XQRVVYSFSA-N |
| XLogP | 2.58 |
| TPSA | 109.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.21 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|