C27H29F5N6O2 — CID 150839335
2-[[2-(3-morpholin-4-ylpropylamino)-4-pyridinyl]methylamino]-N-[4-(1,1,2,2,2-pentafluoroethyl)phenyl]pyridine-3-carboxamide (PubChem CID 150839335) has the molecular formula C27H29F5N6O2 and a molecular weight of 564.56 g/mol. Its IUPAC name is 2-[[2-(3-morpholin-4-ylpropylamino)-4-pyridinyl]methylamino]-N-[4-(1,1,2,2,2-pentafluoroethyl)phenyl]pyridine-3-carboxamide.
| Compound Name | 2-[[2-(3-morpholin-4-ylpropylamino)-4-pyridinyl]methylamino]-N-[4-(1,1,2,2,2-pentafluoroethyl)phenyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 150839335 |
| Molecular Formula | C27H29F5N6O2 |
| Molecular Weight | 564.56 g/mol |
| Exact Mass | 564.23 |
| IUPAC Name | 2-[[2-(3-morpholin-4-ylpropylamino)-4-pyridinyl]methylamino]-N-[4-(1,1,2,2,2-pentafluoroethyl)phenyl]pyridine-3-carboxamide |
| SMILES | O=C(Nc1ccc(C(F)(F)C(F)(F)F)cc1)c1cccnc1NCc1ccnc(NCCCN2CCOCC2)c1 |
| InChI | InChI=1S/C27H29F5N6O2/c28-26(29,27(30,31)32)20-4-6-21(7-5-20)37-25(39)22-3-1-9-35-24(22)36-18-19-8-11-34-23(17-19)33-10-2-12-38-13-15-40-16-14-38/h1,3-9,11,17H,2,10,12-16,18H2,(H,33,34)(H,35,36)(H,37,39) |
| InChIKey | KNQOCZLRQSWUDI-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 91.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.56 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|