C22H44O3 — CID 150842690
1-but-1-enoxy-4-(1,1-diethoxyethyl)dodecane (PubChem CID 150842690) has the molecular formula C22H44O3 and a molecular weight of 356.59 g/mol. Its IUPAC name is 1-but-1-enoxy-4-(1,1-diethoxyethyl)dodecane.
| Compound Name | 1-but-1-enoxy-4-(1,1-diethoxyethyl)dodecane |
|---|---|
| PubChem CID | 150842690 |
| Molecular Formula | C22H44O3 |
| Molecular Weight | 356.59 g/mol |
| Exact Mass | 356.33 |
| IUPAC Name | 1-but-1-enoxy-4-(1,1-diethoxyethyl)dodecane |
| SMILES | CCC=COCCCC(CCCCCCCC)C(C)(OCC)OCC |
| InChI | InChI=1S/C22H44O3/c1-6-10-12-13-14-15-17-21(18-16-20-23-19-11-7-2)22(5,24-8-3)25-9-4/h11,19,21H,6-10,12-18,20H2,1-5H3 |
| InChIKey | KOIGTNYADMQQMS-UHFFFAOYSA-N |
| XLogP | 6.86 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.59 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|