C14H21N3 — CID 150846033
5-(4-methylpiperidin-1-yl)-2,3-dihydroindol-1-amine (PubChem CID 150846033) has the molecular formula C14H21N3 and a molecular weight of 231.34 g/mol. Its IUPAC name is 5-(4-methylpiperidin-1-yl)-2,3-dihydroindol-1-amine.
| Compound Name | 5-(4-methylpiperidin-1-yl)-2,3-dihydroindol-1-amine |
|---|---|
| PubChem CID | 150846033 |
| Molecular Formula | C14H21N3 |
| Molecular Weight | 231.34 g/mol |
| Exact Mass | 231.17 |
| IUPAC Name | 5-(4-methylpiperidin-1-yl)-2,3-dihydroindol-1-amine |
| SMILES | CC1CCN(c2ccc3c(c2)CCN3N)CC1 |
| InChI | InChI=1S/C14H21N3/c1-11-4-7-16(8-5-11)13-2-3-14-12(10-13)6-9-17(14)15/h2-3,10-11H,4-9,15H2,1H3 |
| InChIKey | KPABSCXWPAXTFG-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 32.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.34 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'} |
|---|