C11H22N2 — CID 15085002
1-butyl-2-propan-2-yl-5,6-dihydro-4H-pyrimidine (PubChem CID 15085002) has the molecular formula C11H22N2 and a molecular weight of 182.31 g/mol. Its IUPAC name is 1-butyl-2-propan-2-yl-5,6-dihydro-4H-pyrimidine.
| Compound Name | 1-butyl-2-propan-2-yl-5,6-dihydro-4H-pyrimidine |
|---|---|
| PubChem CID | 15085002 |
| Molecular Formula | C11H22N2 |
| Molecular Weight | 182.31 g/mol |
| Exact Mass | 182.18 |
| IUPAC Name | 1-butyl-2-propan-2-yl-5,6-dihydro-4H-pyrimidine |
| SMILES | CCCCN1CCCN=C1C(C)C |
| InChI | InChI=1S/C11H22N2/c1-4-5-8-13-9-6-7-12-11(13)10(2)3/h10H,4-9H2,1-3H3 |
| InChIKey | IFFOAQRVOWBTKH-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.31 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |