C21H31BrN2O3 — CID 15085641
1-(3-bromo-1,2-oxazol-5-yl)-2-[6-(4-phenylbutoxy)hexylamino]ethanol (PubChem CID 15085641) has the molecular formula C21H31BrN2O3 and a molecular weight of 439.39 g/mol. Its IUPAC name is 1-(3-bromo-1,2-oxazol-5-yl)-2-[6-(4-phenylbutoxy)hexylamino]ethanol.
| Compound Name | 1-(3-bromo-1,2-oxazol-5-yl)-2-[6-(4-phenylbutoxy)hexylamino]ethanol |
|---|---|
| PubChem CID | 15085641 |
| Molecular Formula | C21H31BrN2O3 |
| Molecular Weight | 439.39 g/mol |
| Exact Mass | 438.15 |
| IUPAC Name | 1-(3-bromo-1,2-oxazol-5-yl)-2-[6-(4-phenylbutoxy)hexylamino]ethanol |
| SMILES | OC(CNCCCCCCOCCCCc1ccccc1)c1cc(Br)no1 |
| InChI | InChI=1S/C21H31BrN2O3/c22-21-16-20(27-24-21)19(25)17-23-13-7-1-2-8-14-26-15-9-6-12-18-10-4-3-5-11-18/h3-5,10-11,16,19,23,25H,1-2,6-9,12-15,17H2 |
| InChIKey | YRBCJSCAQSGHCF-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 67.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.39 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|