C25H17Cl3F3N3O3 — CID 150864398
2-[[2-chloro-5-[5-(3,5-dichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]phenyl]hydrazinylidene]-3-phenylpropanoic acid (PubChem CID 150864398) has the molecular formula C25H17Cl3F3N3O3 and a molecular weight of 570.78 g/mol. Its IUPAC name is 2-[[2-chloro-5-[5-(3,5-dichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]phenyl]hydrazinylidene]-3-phenylpropanoic acid.
| Compound Name | 2-[[2-chloro-5-[5-(3,5-dichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]phenyl]hydrazinylidene]-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 150864398 |
| Molecular Formula | C25H17Cl3F3N3O3 |
| Molecular Weight | 570.78 g/mol |
| Exact Mass | 569.03 |
| IUPAC Name | 2-[[2-chloro-5-[5-(3,5-dichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]phenyl]hydrazinylidene]-3-phenylpropanoic acid |
| SMILES | O=C(O)C(Cc1ccccc1)=NNc1cc(C2=NOC(c3cc(Cl)cc(Cl)c3)(C(F)(F)F)C2)ccc1Cl |
| InChI | InChI=1S/C25H17Cl3F3N3O3/c26-17-10-16(11-18(27)12-17)24(25(29,30)31)13-22(34-37-24)15-6-7-19(28)20(9-15)32-33-21(23(35)36)8-14-4-2-1-3-5-14/h1-7,9-12,32H,8,13H2,(H,35,36) |
| InChIKey | KSTCIZBIGDMOFA-UHFFFAOYSA-N |
| XLogP | 7.32 |
| TPSA | 83.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.78 |
| LogP ≤ 5 | 7.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|