About dichlororuthenium;2-methyl-5-phenyl-1H-inden-1-ide
dichlororuthenium;2-methyl-5-phenyl-1H-inden-1-ide (PubChem CID 150866030) has the molecular formula C16H13Cl2Ru-
and a molecular weight of 377.26 g/mol. Its IUPAC name is dichlororuthenium;2-methyl-5-phenyl-1H-inden-1-ide.
Molecular Properties
| Compound Name | dichlororuthenium;2-methyl-5-phenyl-1H-inden-1-ide |
| PubChem CID | 150866030 |
| Molecular Formula | C16H13Cl2Ru- |
| Molecular Weight | 377.26 g/mol |
| Exact Mass | 376.94 |
| IUPAC Name | dichlororuthenium;2-methyl-5-phenyl-1H-inden-1-ide |
| SMILES | Cc1cc2cc(-c3ccccc3)ccc2[cH-]1.Cl[Ru]Cl |
| InChI | InChI=1S/C16H13.2ClH.Ru/c1-12-9-14-7-8-15(11-16(14)10-12)13-5-3-2-4-6-13;;;/h2-11H,1H3;2*1H;/q-1;;;+2/p-2 |
| InChIKey | AKWZWIIFAKEOLJ-UHFFFAOYSA-L |
| XLogP | 5.91 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 377.26 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze dichlororuthenium;2-methyl-5-phenyl-1H-inden-1-ide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dichlororuthenium;2-methyl-5-phenyl-1H-inden-1-ide?
The IUPAC name of dichlororuthenium;2-methyl-5-phenyl-1H-inden-1-ide (CID 150866030) is dichlororuthenium;2-methyl-5-phenyl-1H-inden-1-ide.
What is the SMILES notation for dichlororuthenium;2-methyl-5-phenyl-1H-inden-1-ide?
The canonical SMILES for dichlororuthenium;2-methyl-5-phenyl-1H-inden-1-ide is Cc1cc2cc(-c3ccccc3)ccc2[cH-]1.Cl[Ru]Cl.
What is the InChIKey of dichlororuthenium;2-methyl-5-phenyl-1H-inden-1-ide?
The InChIKey is AKWZWIIFAKEOLJ-UHFFFAOYSA-L. The full InChI is InChI=1S/C16H13.2ClH.Ru/c1-12-9-14-7-8-15(11-16(14)10-12)13-5-3-2-4-6-13;;;/h2-11H,1H3;2*1H;/q-1;;;+2/p-2.
What are the key properties of dichlororuthenium;2-methyl-5-phenyl-1H-inden-1-ide?
dichlororuthenium;2-methyl-5-phenyl-1H-inden-1-ide has a molecular weight of 377.26 g/mol, XLogP of 5.91, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for dichlororuthenium;2-methyl-5-phenyl-1H-inden-1-ide is sourced from PubChem (CID 150866030), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).