C37H35N3O2 — CID 150867512
N-butyl-5,6-bis(4-phenylmethoxyphenyl)-1H-indazol-3-amine (PubChem CID 150867512) has the molecular formula C37H35N3O2 and a molecular weight of 553.71 g/mol. Its IUPAC name is N-butyl-5,6-bis(4-phenylmethoxyphenyl)-1H-indazol-3-amine.
| Compound Name | N-butyl-5,6-bis(4-phenylmethoxyphenyl)-1H-indazol-3-amine |
|---|---|
| PubChem CID | 150867512 |
| Molecular Formula | C37H35N3O2 |
| Molecular Weight | 553.71 g/mol |
| Exact Mass | 553.27 |
| IUPAC Name | N-butyl-5,6-bis(4-phenylmethoxyphenyl)-1H-indazol-3-amine |
| SMILES | CCCCNc1n[nH]c2cc(-c3ccc(OCc4ccccc4)cc3)c(-c3ccc(OCc4ccccc4)cc3)cc12 |
| InChI | InChI=1S/C37H35N3O2/c1-2-3-22-38-37-35-23-33(29-14-18-31(19-15-29)41-25-27-10-6-4-7-11-27)34(24-36(35)39-40-37)30-16-20-32(21-17-30)42-26-28-12-8-5-9-13-28/h4-21,23-24H,2-3,22,25-26H2,1H3,(H2,38,39,40) |
| InChIKey | KTJBYTNHPXOPRX-UHFFFAOYSA-N |
| XLogP | 9.27 |
| TPSA | 59.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.71 |
| LogP ≤ 5 | 9.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|