C20H28O4 — CID 150871018
2,3-dimethyl-1,4-bis(propoxymethoxy)naphthalene (PubChem CID 150871018) has the molecular formula C20H28O4 and a molecular weight of 332.44 g/mol. Its IUPAC name is 2,3-dimethyl-1,4-bis(propoxymethoxy)naphthalene.
| Compound Name | 2,3-dimethyl-1,4-bis(propoxymethoxy)naphthalene |
|---|---|
| PubChem CID | 150871018 |
| Molecular Formula | C20H28O4 |
| Molecular Weight | 332.44 g/mol |
| Exact Mass | 332.20 |
| IUPAC Name | 2,3-dimethyl-1,4-bis(propoxymethoxy)naphthalene |
| SMILES | CCCOCOc1c(C)c(C)c(OCOCCC)c2ccccc12 |
| InChI | InChI=1S/C20H28O4/c1-5-11-21-13-23-19-15(3)16(4)20(24-14-22-12-6-2)18-10-8-7-9-17(18)19/h7-10H,5-6,11-14H2,1-4H3 |
| InChIKey | KUAOZRHWDCBFCU-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.44 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|