C22H32O2 — CID 153323329
2,3-dimethyl-1,4-bis(3-methylbutoxy)naphthalene (PubChem CID 153323329) has the molecular formula C22H32O2 and a molecular weight of 328.50 g/mol. Its IUPAC name is 2,3-dimethyl-1,4-bis(3-methylbutoxy)naphthalene.
| Compound Name | 2,3-dimethyl-1,4-bis(3-methylbutoxy)naphthalene |
|---|---|
| PubChem CID | 153323329 |
| Molecular Formula | C22H32O2 |
| Molecular Weight | 328.50 g/mol |
| Exact Mass | 328.24 |
| IUPAC Name | 2,3-dimethyl-1,4-bis(3-methylbutoxy)naphthalene |
| SMILES | Cc1c(C)c(OCCC(C)C)c2ccccc2c1OCCC(C)C |
| InChI | InChI=1S/C22H32O2/c1-15(2)11-13-23-21-17(5)18(6)22(24-14-12-16(3)4)20-10-8-7-9-19(20)21/h7-10,15-16H,11-14H2,1-6H3 |
| InChIKey | ZCFQOOPBFHTIHS-UHFFFAOYSA-N |
| XLogP | 6.31 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.50 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |