C19H21F3OS — CID 150872718
1-[6-[4-(trifluoromethyl)cyclohexyl]oxynaphthalen-2-yl]ethanethiol (PubChem CID 150872718) has the molecular formula C19H21F3OS and a molecular weight of 354.44 g/mol. Its IUPAC name is 1-[6-[4-(trifluoromethyl)cyclohexyl]oxynaphthalen-2-yl]ethanethiol.
| Compound Name | 1-[6-[4-(trifluoromethyl)cyclohexyl]oxynaphthalen-2-yl]ethanethiol |
|---|---|
| PubChem CID | 150872718 |
| Molecular Formula | C19H21F3OS |
| Molecular Weight | 354.44 g/mol |
| Exact Mass | 354.13 |
| IUPAC Name | 1-[6-[4-(trifluoromethyl)cyclohexyl]oxynaphthalen-2-yl]ethanethiol |
| SMILES | CC(S)c1ccc2cc(OC3CCC(C(F)(F)F)CC3)ccc2c1 |
| InChI | InChI=1S/C19H21F3OS/c1-12(24)13-2-3-15-11-18(7-4-14(15)10-13)23-17-8-5-16(6-9-17)19(20,21)22/h2-4,7,10-12,16-17,24H,5-6,8-9H2,1H3 |
| InChIKey | KUJKFBHPCDCVSR-UHFFFAOYSA-N |
| XLogP | 6.33 |
| TPSA | 9.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.44 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|