C35H39Br2F3O5S — CID 159347861
2-bromo-7-(4-methylcyclohexyl)oxynaphthalene;7-bromonaphthalen-2-ol;[4-(trifluoromethyl)cyclohexyl] methanesulfonate (PubChem CID 159347861) has the molecular formula C35H39Br2F3O5S and a molecular weight of 788.56 g/mol. Its IUPAC name is 2-bromo-7-(4-methylcyclohexyl)oxynaphthalene;7-bromonaphthalen-2-ol;[4-(trifluoromethyl)cyclohexyl] methanesulfonate.
| Compound Name | 2-bromo-7-(4-methylcyclohexyl)oxynaphthalene;7-bromonaphthalen-2-ol;[4-(trifluoromethyl)cyclohexyl] methanesulfonate |
|---|---|
| PubChem CID | 159347861 |
| Molecular Formula | C35H39Br2F3O5S |
| Molecular Weight | 788.56 g/mol |
| Exact Mass | 786.08 |
| IUPAC Name | 2-bromo-7-(4-methylcyclohexyl)oxynaphthalene;7-bromonaphthalen-2-ol;[4-(trifluoromethyl)cyclohexyl] methanesulfonate |
| SMILES | CC1CCC(Oc2ccc3ccc(Br)cc3c2)CC1.CS(=O)(=O)OC1CCC(C(F)(F)F)CC1.Oc1ccc2ccc(Br)cc2c1 |
| InChI | InChI=1S/C17H19BrO.C10H7BrO.C8H13F3O3S/c1-12-2-7-16(8-3-12)19-17-9-5-13-4-6-15(18)10-14(13)11-17;11-9-3-1-7-2-4-10(12)6-8(7)5-9;1-15(12,13)14-7-4-2-6(3-5-7)8(9,10)11/h4-6,9-12,16H,2-3,7-8H2,1H3;1-6,12H;6-7H,2-5H2,1H3 |
| InChIKey | LGYKWGWFAOGKIJ-UHFFFAOYSA-N |
| XLogP | 10.95 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 788.56 |
| LogP ≤ 5 | 10.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|