C18H21BrO — CID 123862980
6-bromo-1-methyl-2-(4-methylcyclohexyl)oxynaphthalene (PubChem CID 123862980) has the molecular formula C18H21BrO and a molecular weight of 333.27 g/mol. Its IUPAC name is 6-bromo-1-methyl-2-(4-methylcyclohexyl)oxynaphthalene.
| Compound Name | 6-bromo-1-methyl-2-(4-methylcyclohexyl)oxynaphthalene |
|---|---|
| PubChem CID | 123862980 |
| Molecular Formula | C18H21BrO |
| Molecular Weight | 333.27 g/mol |
| Exact Mass | 332.08 |
| IUPAC Name | 6-bromo-1-methyl-2-(4-methylcyclohexyl)oxynaphthalene |
| SMILES | Cc1c(OC2CCC(C)CC2)ccc2cc(Br)ccc12 |
| InChI | InChI=1S/C18H21BrO/c1-12-3-7-16(8-4-12)20-18-10-5-14-11-15(19)6-9-17(14)13(18)2/h5-6,9-12,16H,3-4,7-8H2,1-2H3 |
| InChIKey | PEGKRXHLERRGRZ-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.27 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |