C24H35NO2 — CID 67413963
(2R)-2-amino-2-[6-(4-tert-butylcyclohexyl)oxy-5-methylnaphthalen-2-yl]propan-1-ol (PubChem CID 67413963) has the molecular formula C24H35NO2 and a molecular weight of 369.55 g/mol. Its IUPAC name is (2R)-2-amino-2-[6-(4-tert-butylcyclohexyl)oxy-5-methylnaphthalen-2-yl]propan-1-ol.
| Compound Name | (2R)-2-amino-2-[6-(4-tert-butylcyclohexyl)oxy-5-methylnaphthalen-2-yl]propan-1-ol |
|---|---|
| PubChem CID | 67413963 |
| Molecular Formula | C24H35NO2 |
| Molecular Weight | 369.55 g/mol |
| Exact Mass | 369.27 |
| IUPAC Name | (2R)-2-amino-2-[6-(4-tert-butylcyclohexyl)oxy-5-methylnaphthalen-2-yl]propan-1-ol |
| SMILES | Cc1c(OC2CCC(C(C)(C)C)CC2)ccc2cc([C@@](C)(N)CO)ccc12 |
| InChI | InChI=1S/C24H35NO2/c1-16-21-12-9-19(24(5,25)15-26)14-17(21)6-13-22(16)27-20-10-7-18(8-11-20)23(2,3)4/h6,9,12-14,18,20,26H,7-8,10-11,15,25H2,1-5H3/t18?,20?,24-/m0/s1 |
| InChIKey | KOCMRIGDXZWIAT-IWRZYZMASA-N |
| XLogP | 5.30 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.55 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |