C23H33NO2 — CID 46196153
(2R)-2-amino-2-[6-(4-butylcyclohexyl)oxynaphthalen-2-yl]propan-1-ol (PubChem CID 46196153) has the molecular formula C23H33NO2 and a molecular weight of 355.52 g/mol. Its IUPAC name is (2R)-2-amino-2-[6-(4-butylcyclohexyl)oxynaphthalen-2-yl]propan-1-ol.
| Compound Name | (2R)-2-amino-2-[6-(4-butylcyclohexyl)oxynaphthalen-2-yl]propan-1-ol |
|---|---|
| PubChem CID | 46196153 |
| Molecular Formula | C23H33NO2 |
| Molecular Weight | 355.52 g/mol |
| Exact Mass | 355.25 |
| IUPAC Name | (2R)-2-amino-2-[6-(4-butylcyclohexyl)oxynaphthalen-2-yl]propan-1-ol |
| SMILES | CCCCC1CCC(Oc2ccc3cc([C@@](C)(N)CO)ccc3c2)CC1 |
| InChI | InChI=1S/C23H33NO2/c1-3-4-5-17-6-11-21(12-7-17)26-22-13-9-18-14-20(23(2,24)16-25)10-8-19(18)15-22/h8-10,13-15,17,21,25H,3-7,11-12,16,24H2,1-2H3/t17?,21?,23-/m0/s1 |
| InChIKey | MDKFBFIRRUQMLA-WJXHAUQLSA-N |
| XLogP | 5.13 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.52 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |