C24H35NO2 — CID 71280398
(2R)-2-amino-3-[6-(3-pentylcyclohexyl)oxynaphthalen-2-yl]propan-1-ol (PubChem CID 71280398) has the molecular formula C24H35NO2 and a molecular weight of 369.55 g/mol. Its IUPAC name is (2R)-2-amino-3-[6-(3-pentylcyclohexyl)oxynaphthalen-2-yl]propan-1-ol.
| Compound Name | (2R)-2-amino-3-[6-(3-pentylcyclohexyl)oxynaphthalen-2-yl]propan-1-ol |
|---|---|
| PubChem CID | 71280398 |
| Molecular Formula | C24H35NO2 |
| Molecular Weight | 369.55 g/mol |
| Exact Mass | 369.27 |
| IUPAC Name | (2R)-2-amino-3-[6-(3-pentylcyclohexyl)oxynaphthalen-2-yl]propan-1-ol |
| SMILES | CCCCCC1CCCC(Oc2ccc3cc(C[C@@H](N)CO)ccc3c2)C1 |
| InChI | InChI=1S/C24H35NO2/c1-2-3-4-6-18-7-5-8-23(15-18)27-24-12-11-20-13-19(14-22(25)17-26)9-10-21(20)16-24/h9-13,16,18,22-23,26H,2-8,14-15,17,25H2,1H3/t18?,22-,23?/m1/s1 |
| InChIKey | JMTUZMKBYWSHPI-PDGCRQIGSA-N |
| XLogP | 5.22 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.55 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|