C21H23NO2 — CID 46196317
(2R)-2-amino-2-[6-(4-ethylphenoxy)naphthalen-2-yl]propan-1-ol (PubChem CID 46196317) has the molecular formula C21H23NO2 and a molecular weight of 321.42 g/mol. Its IUPAC name is (2R)-2-amino-2-[6-(4-ethylphenoxy)naphthalen-2-yl]propan-1-ol.
| Compound Name | (2R)-2-amino-2-[6-(4-ethylphenoxy)naphthalen-2-yl]propan-1-ol |
|---|---|
| PubChem CID | 46196317 |
| Molecular Formula | C21H23NO2 |
| Molecular Weight | 321.42 g/mol |
| Exact Mass | 321.17 |
| IUPAC Name | (2R)-2-amino-2-[6-(4-ethylphenoxy)naphthalen-2-yl]propan-1-ol |
| SMILES | CCc1ccc(Oc2ccc3cc([C@@](C)(N)CO)ccc3c2)cc1 |
| InChI | InChI=1S/C21H23NO2/c1-3-15-4-9-19(10-5-15)24-20-11-7-16-12-18(21(2,22)14-23)8-6-17(16)13-20/h4-13,23H,3,14,22H2,1-2H3/t21-/m0/s1 |
| InChIKey | BZVYSCNFVFCWQC-NRFANRHFSA-N |
| XLogP | 4.36 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.42 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |