C23H29NO2 — CID 67531962
2-[6-(2-adamantyloxy)naphthalen-2-yl]-2-aminopropan-1-ol (PubChem CID 67531962) has the molecular formula C23H29NO2 and a molecular weight of 351.49 g/mol. Its IUPAC name is 2-[6-(2-adamantyloxy)naphthalen-2-yl]-2-aminopropan-1-ol.
| Compound Name | 2-[6-(2-adamantyloxy)naphthalen-2-yl]-2-aminopropan-1-ol |
|---|---|
| PubChem CID | 67531962 |
| Molecular Formula | C23H29NO2 |
| Molecular Weight | 351.49 g/mol |
| Exact Mass | 351.22 |
| IUPAC Name | 2-[6-(2-adamantyloxy)naphthalen-2-yl]-2-aminopropan-1-ol |
| SMILES | CC(N)(CO)c1ccc2cc(OC3C4CC5CC(C4)CC3C5)ccc2c1 |
| InChI | InChI=1S/C23H29NO2/c1-23(24,13-25)20-4-2-17-12-21(5-3-16(17)11-20)26-22-18-7-14-6-15(9-18)10-19(22)8-14/h2-5,11-12,14-15,18-19,22,25H,6-10,13,24H2,1H3 |
| InChIKey | TWOIAYLTLDNCRE-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.49 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |