C22H31NO2 — CID 46196262
(2R)-2-amino-2-[6-(4-propan-2-ylcyclohexyl)oxynaphthalen-2-yl]propan-1-ol (PubChem CID 46196262) has the molecular formula C22H31NO2 and a molecular weight of 341.50 g/mol. Its IUPAC name is (2R)-2-amino-2-[6-(4-propan-2-ylcyclohexyl)oxynaphthalen-2-yl]propan-1-ol.
| Compound Name | (2R)-2-amino-2-[6-(4-propan-2-ylcyclohexyl)oxynaphthalen-2-yl]propan-1-ol |
|---|---|
| PubChem CID | 46196262 |
| Molecular Formula | C22H31NO2 |
| Molecular Weight | 341.50 g/mol |
| Exact Mass | 341.24 |
| IUPAC Name | (2R)-2-amino-2-[6-(4-propan-2-ylcyclohexyl)oxynaphthalen-2-yl]propan-1-ol |
| SMILES | CC(C)C1CCC(Oc2ccc3cc([C@@](C)(N)CO)ccc3c2)CC1 |
| InChI | InChI=1S/C22H31NO2/c1-15(2)16-5-9-20(10-6-16)25-21-11-7-17-12-19(22(3,23)14-24)8-4-18(17)13-21/h4,7-8,11-13,15-16,20,24H,5-6,9-10,14,23H2,1-3H3/t16?,20?,22-/m0/s1 |
| InChIKey | KAVYMBJYUOWHMH-STKUJCBHSA-N |
| XLogP | 4.60 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.50 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |