C24H32BrIO — CID 126757460
6-bromo-2-[4-(2,5-dimethylhexan-2-yl)cyclohexyl]oxy-1-iodonaphthalene (PubChem CID 126757460) has the molecular formula C24H32BrIO and a molecular weight of 543.33 g/mol. Its IUPAC name is 6-bromo-2-[4-(2,5-dimethylhexan-2-yl)cyclohexyl]oxy-1-iodonaphthalene.
| Compound Name | 6-bromo-2-[4-(2,5-dimethylhexan-2-yl)cyclohexyl]oxy-1-iodonaphthalene |
|---|---|
| PubChem CID | 126757460 |
| Molecular Formula | C24H32BrIO |
| Molecular Weight | 543.33 g/mol |
| Exact Mass | 542.07 |
| IUPAC Name | 6-bromo-2-[4-(2,5-dimethylhexan-2-yl)cyclohexyl]oxy-1-iodonaphthalene |
| SMILES | CC(C)CCC(C)(C)C1CCC(Oc2ccc3cc(Br)ccc3c2I)CC1 |
| InChI | InChI=1S/C24H32BrIO/c1-16(2)13-14-24(3,4)18-6-9-20(10-7-18)27-22-12-5-17-15-19(25)8-11-21(17)23(22)26/h5,8,11-12,15-16,18,20H,6-7,9-10,13-14H2,1-4H3 |
| InChIKey | FRQYCPCRCWXJGP-UHFFFAOYSA-N |
| XLogP | 8.61 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.33 |
| LogP ≤ 5 | 8.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|