C12H18BClN2O4 — CID 150875180
[3-chloro-2-[ethyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]-4-pyridinyl]boronic acid (PubChem CID 150875180) has the molecular formula C12H18BClN2O4 and a molecular weight of 300.55 g/mol. Its IUPAC name is [3-chloro-2-[ethyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]-4-pyridinyl]boronic acid.
| Compound Name | [3-chloro-2-[ethyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]-4-pyridinyl]boronic acid |
|---|---|
| PubChem CID | 150875180 |
| Molecular Formula | C12H18BClN2O4 |
| Molecular Weight | 300.55 g/mol |
| Exact Mass | 300.10 |
| IUPAC Name | [3-chloro-2-[ethyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]-4-pyridinyl]boronic acid |
| SMILES | CCN(C(=O)OC(C)(C)C)c1nccc(B(O)O)c1Cl |
| InChI | InChI=1S/C12H18BClN2O4/c1-5-16(11(17)20-12(2,3)4)10-9(14)8(13(18)19)6-7-15-10/h6-7,18-19H,5H2,1-4H3 |
| InChIKey | KUVVKBPQJADPCQ-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 82.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.55 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|