C14H23BN2O4 — CID 163278196
[2-[(1R)-1-[ethyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]ethyl]-4-pyridinyl]boronic acid (PubChem CID 163278196) has the molecular formula C14H23BN2O4 and a molecular weight of 294.16 g/mol. Its IUPAC name is [2-[(1R)-1-[ethyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]ethyl]-4-pyridinyl]boronic acid.
| Compound Name | [2-[(1R)-1-[ethyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]ethyl]-4-pyridinyl]boronic acid |
|---|---|
| PubChem CID | 163278196 |
| Molecular Formula | C14H23BN2O4 |
| Molecular Weight | 294.16 g/mol |
| Exact Mass | 294.18 |
| IUPAC Name | [2-[(1R)-1-[ethyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]ethyl]-4-pyridinyl]boronic acid |
| SMILES | CCN(C(=O)OC(C)(C)C)[C@H](C)c1cc(B(O)O)ccn1 |
| InChI | InChI=1S/C14H23BN2O4/c1-6-17(13(18)21-14(3,4)5)10(2)12-9-11(15(19)20)7-8-16-12/h7-10,19-20H,6H2,1-5H3/t10-/m1/s1 |
| InChIKey | ISZQGLMXITZIOP-SNVBAGLBSA-N |
| XLogP | 1.08 |
| TPSA | 82.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.16 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|