C14H20ClFN2O2 — CID 163278312
tert-butyl N-[1-(4-chloro-5-fluoro-2-pyridinyl)ethyl]-N-ethylcarbamate (PubChem CID 163278312) has the molecular formula C14H20ClFN2O2 and a molecular weight of 302.78 g/mol. Its IUPAC name is tert-butyl N-[1-(4-chloro-5-fluoro-2-pyridinyl)ethyl]-N-ethylcarbamate.
| Compound Name | tert-butyl N-[1-(4-chloro-5-fluoro-2-pyridinyl)ethyl]-N-ethylcarbamate |
|---|---|
| PubChem CID | 163278312 |
| Molecular Formula | C14H20ClFN2O2 |
| Molecular Weight | 302.78 g/mol |
| Exact Mass | 302.12 |
| IUPAC Name | tert-butyl N-[1-(4-chloro-5-fluoro-2-pyridinyl)ethyl]-N-ethylcarbamate |
| SMILES | CCN(C(=O)OC(C)(C)C)C(C)c1cc(Cl)c(F)cn1 |
| InChI | InChI=1S/C14H20ClFN2O2/c1-6-18(13(19)20-14(3,4)5)9(2)12-7-10(15)11(16)8-17-12/h7-9H,6H2,1-5H3 |
| InChIKey | BZAWUUILHPQQQE-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.78 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |