C19H26ClFN2O5 — CID 177300717
tert-butyl N-[2-chloro-3-[(E)-2-ethoxyethenyl]-5-fluoro-4-pyridinyl]-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamate (PubChem CID 177300717) has the molecular formula C19H26ClFN2O5 and a molecular weight of 416.88 g/mol. Its IUPAC name is tert-butyl N-[2-chloro-3-[(E)-2-ethoxyethenyl]-5-fluoro-4-pyridinyl]-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamate.
| Compound Name | tert-butyl N-[2-chloro-3-[(E)-2-ethoxyethenyl]-5-fluoro-4-pyridinyl]-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamate |
|---|---|
| PubChem CID | 177300717 |
| Molecular Formula | C19H26ClFN2O5 |
| Molecular Weight | 416.88 g/mol |
| Exact Mass | 416.15 |
| IUPAC Name | tert-butyl N-[2-chloro-3-[(E)-2-ethoxyethenyl]-5-fluoro-4-pyridinyl]-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamate |
| SMILES | CCO/C=C/c1c(Cl)ncc(F)c1N(C(=O)OC(C)(C)C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C19H26ClFN2O5/c1-8-26-10-9-12-14(13(21)11-22-15(12)20)23(16(24)27-18(2,3)4)17(25)28-19(5,6)7/h9-11H,8H2,1-7H3/b10-9+ |
| InChIKey | XYDPKCDHCUQLJB-MDZDMXLPSA-N |
| XLogP | 5.56 |
| TPSA | 77.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.88 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|