C12H16Cl2N2O3 — CID 86634701
tert-butyl N-[(5,6-dichloro-3-pyridinyl)methyl]-N-methoxycarbamate (PubChem CID 86634701) has the molecular formula C12H16Cl2N2O3 and a molecular weight of 307.18 g/mol. Its IUPAC name is tert-butyl N-[(5,6-dichloro-3-pyridinyl)methyl]-N-methoxycarbamate.
| Compound Name | tert-butyl N-[(5,6-dichloro-3-pyridinyl)methyl]-N-methoxycarbamate |
|---|---|
| PubChem CID | 86634701 |
| Molecular Formula | C12H16Cl2N2O3 |
| Molecular Weight | 307.18 g/mol |
| Exact Mass | 306.05 |
| IUPAC Name | tert-butyl N-[(5,6-dichloro-3-pyridinyl)methyl]-N-methoxycarbamate |
| SMILES | CON(Cc1cnc(Cl)c(Cl)c1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C12H16Cl2N2O3/c1-12(2,3)19-11(17)16(18-4)7-8-5-9(13)10(14)15-6-8/h5-6H,7H2,1-4H3 |
| InChIKey | ZNSVIZRIZCEXCJ-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 51.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.18 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|