C15H21Cl2N3O2 — CID 90765930
tert-butyl N-[1-(5,6-dichloro-3-pyridinyl)pyrrolidin-2-yl]-N-methylcarbamate (PubChem CID 90765930) has the molecular formula C15H21Cl2N3O2 and a molecular weight of 346.26 g/mol. Its IUPAC name is tert-butyl N-[1-(5,6-dichloro-3-pyridinyl)pyrrolidin-2-yl]-N-methylcarbamate.
| Compound Name | tert-butyl N-[1-(5,6-dichloro-3-pyridinyl)pyrrolidin-2-yl]-N-methylcarbamate |
|---|---|
| PubChem CID | 90765930 |
| Molecular Formula | C15H21Cl2N3O2 |
| Molecular Weight | 346.26 g/mol |
| Exact Mass | 345.10 |
| IUPAC Name | tert-butyl N-[1-(5,6-dichloro-3-pyridinyl)pyrrolidin-2-yl]-N-methylcarbamate |
| SMILES | CN(C(=O)OC(C)(C)C)C1CCCN1c1cnc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C15H21Cl2N3O2/c1-15(2,3)22-14(21)19(4)12-6-5-7-20(12)10-8-11(16)13(17)18-9-10/h8-9,12H,5-7H2,1-4H3 |
| InChIKey | GZXBSYNHFWMJTK-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 45.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.26 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|