C10H12ClFN2O2 — CID 169005645
1-(4-chloro-5-fluoro-2-pyridinyl)ethyl N-ethylcarbamate (PubChem CID 169005645) has the molecular formula C10H12ClFN2O2 and a molecular weight of 246.67 g/mol. Its IUPAC name is 1-(4-chloro-5-fluoro-2-pyridinyl)ethyl N-ethylcarbamate.
| Compound Name | 1-(4-chloro-5-fluoro-2-pyridinyl)ethyl N-ethylcarbamate |
|---|---|
| PubChem CID | 169005645 |
| Molecular Formula | C10H12ClFN2O2 |
| Molecular Weight | 246.67 g/mol |
| Exact Mass | 246.06 |
| IUPAC Name | 1-(4-chloro-5-fluoro-2-pyridinyl)ethyl N-ethylcarbamate |
| SMILES | CCNC(=O)OC(C)c1cc(Cl)c(F)cn1 |
| InChI | InChI=1S/C10H12ClFN2O2/c1-3-13-10(15)16-6(2)9-4-7(11)8(12)5-14-9/h4-6H,3H2,1-2H3,(H,13,15) |
| InChIKey | MQJJEQYFTSUIMY-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.67 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |