C14H21BN2O4 — CID 67328274
[2-[4-[(2-methylpropan-2-yl)oxycarbonylamino]but-3-enyl]-4-pyridinyl]boronic acid (PubChem CID 67328274) has the molecular formula C14H21BN2O4 and a molecular weight of 292.14 g/mol. Its IUPAC name is [2-[4-[(2-methylpropan-2-yl)oxycarbonylamino]but-3-enyl]-4-pyridinyl]boronic acid.
| Compound Name | [2-[4-[(2-methylpropan-2-yl)oxycarbonylamino]but-3-enyl]-4-pyridinyl]boronic acid |
|---|---|
| PubChem CID | 67328274 |
| Molecular Formula | C14H21BN2O4 |
| Molecular Weight | 292.14 g/mol |
| Exact Mass | 292.16 |
| IUPAC Name | [2-[4-[(2-methylpropan-2-yl)oxycarbonylamino]but-3-enyl]-4-pyridinyl]boronic acid |
| SMILES | CC(C)(C)OC(=O)NC=CCCc1cc(B(O)O)ccn1 |
| InChI | InChI=1S/C14H21BN2O4/c1-14(2,3)21-13(18)17-8-5-4-6-12-10-11(15(19)20)7-9-16-12/h5,7-10,19-20H,4,6H2,1-3H3,(H,17,18) |
| InChIKey | JDMPSUGOTJEFHH-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 91.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.14 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|