C23H42N4 — CID 150875218
1-N-[3-[5-[(2S)-1-methylpyrrolidin-2-yl]-3-pyridinyl]propyl]decane-1,6-diamine (PubChem CID 150875218) has the molecular formula C23H42N4 and a molecular weight of 374.62 g/mol. Its IUPAC name is 1-N-[3-[5-[(2S)-1-methylpyrrolidin-2-yl]-3-pyridinyl]propyl]decane-1,6-diamine.
| Compound Name | 1-N-[3-[5-[(2S)-1-methylpyrrolidin-2-yl]-3-pyridinyl]propyl]decane-1,6-diamine |
|---|---|
| PubChem CID | 150875218 |
| Molecular Formula | C23H42N4 |
| Molecular Weight | 374.62 g/mol |
| Exact Mass | 374.34 |
| IUPAC Name | 1-N-[3-[5-[(2S)-1-methylpyrrolidin-2-yl]-3-pyridinyl]propyl]decane-1,6-diamine |
| SMILES | CCCCC(N)CCCCCNCCCc1cncc([C@@H]2CCCN2C)c1 |
| InChI | InChI=1S/C23H42N4/c1-3-4-11-22(24)12-6-5-7-14-25-15-8-10-20-17-21(19-26-18-20)23-13-9-16-27(23)2/h17-19,22-23,25H,3-16,24H2,1-2H3/t22?,23-/m0/s1 |
| InChIKey | KUWAAYVBLKKCNV-WCSIJFPASA-N |
| XLogP | 4.45 |
| TPSA | 54.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.62 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|