C23H39N3OS — CID 150875545
N-[(1R,5S)-5-(decylamino)-1-bicyclo[3.2.1]octanyl]-4-methyl-1,3-thiazole-2-carboxamide (PubChem CID 150875545) has the molecular formula C23H39N3OS and a molecular weight of 405.65 g/mol. Its IUPAC name is N-[(1R,5S)-5-(decylamino)-1-bicyclo[3.2.1]octanyl]-4-methyl-1,3-thiazole-2-carboxamide.
| Compound Name | N-[(1R,5S)-5-(decylamino)-1-bicyclo[3.2.1]octanyl]-4-methyl-1,3-thiazole-2-carboxamide |
|---|---|
| PubChem CID | 150875545 |
| Molecular Formula | C23H39N3OS |
| Molecular Weight | 405.65 g/mol |
| Exact Mass | 405.28 |
| IUPAC Name | N-[(1R,5S)-5-(decylamino)-1-bicyclo[3.2.1]octanyl]-4-methyl-1,3-thiazole-2-carboxamide |
| SMILES | CCCCCCCCCCN[C@@]12CCC[C@@](NC(=O)c3nc(C)cs3)(CC1)C2 |
| InChI | InChI=1S/C23H39N3OS/c1-3-4-5-6-7-8-9-10-16-24-22-12-11-13-23(18-22,15-14-22)26-20(27)21-25-19(2)17-28-21/h17,24H,3-16,18H2,1-2H3,(H,26,27)/t22-,23+/m0/s1 |
| InChIKey | KUXTUEKZWWJDBT-XZOQPEGZSA-N |
| XLogP | 5.76 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.65 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|