C29H42N10O2 — CID 150887261
N-[(3R)-1-[6-carbamimidoyl-5-[4-(1-propanoylpiperidin-4-yl)anilino]-1,2,4-triazin-3-yl]piperidin-3-yl]piperidine-1-carboxamide (PubChem CID 150887261) has the molecular formula C29H42N10O2 and a molecular weight of 562.72 g/mol. Its IUPAC name is N-[(3R)-1-[6-carbamimidoyl-5-[4-(1-propanoylpiperidin-4-yl)anilino]-1,2,4-triazin-3-yl]piperidin-3-yl]piperidine-1-carboxamide.
| Compound Name | N-[(3R)-1-[6-carbamimidoyl-5-[4-(1-propanoylpiperidin-4-yl)anilino]-1,2,4-triazin-3-yl]piperidin-3-yl]piperidine-1-carboxamide |
|---|---|
| PubChem CID | 150887261 |
| Molecular Formula | C29H42N10O2 |
| Molecular Weight | 562.72 g/mol |
| Exact Mass | 562.35 |
| IUPAC Name | N-[(3R)-1-[6-carbamimidoyl-5-[4-(1-propanoylpiperidin-4-yl)anilino]-1,2,4-triazin-3-yl]piperidin-3-yl]piperidine-1-carboxamide |
| SMILES | [H]/N=C(\N)c1nnc(N2CCC[C@@H](NC(=O)N3CCCCC3)C2)nc1Nc1ccc(C2CCN(C(=O)CC)CC2)cc1 |
| InChI | InChI=1S/C29H42N10O2/c1-2-24(40)37-17-12-21(13-18-37)20-8-10-22(11-9-20)32-27-25(26(30)31)35-36-28(34-27)39-16-6-7-23(19-39)33-29(41)38-14-4-3-5-15-38/h8-11,21,23H,2-7,12-19H2,1H3,(H3,30,31)(H,33,41)(H,32,34,36)/t23-/m1/s1 |
| InChIKey | KXGWZDKIYPMEMF-HSZRJFAPSA-N |
| XLogP | 3.18 |
| TPSA | 156.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.72 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|