C29H35N9O3 — CID 118114699
3-[3-[(4-ethoxybenzoyl)amino]piperidin-1-yl]-5-[4-(pyrrolidine-1-carboximidoyl)anilino]-1,2,4-triazine-6-carboxamide (PubChem CID 118114699) has the molecular formula C29H35N9O3 and a molecular weight of 557.66 g/mol. Its IUPAC name is 3-[3-[(4-ethoxybenzoyl)amino]piperidin-1-yl]-5-[4-(pyrrolidine-1-carboximidoyl)anilino]-1,2,4-triazine-6-carboxamide.
| Compound Name | 3-[3-[(4-ethoxybenzoyl)amino]piperidin-1-yl]-5-[4-(pyrrolidine-1-carboximidoyl)anilino]-1,2,4-triazine-6-carboxamide |
|---|---|
| PubChem CID | 118114699 |
| Molecular Formula | C29H35N9O3 |
| Molecular Weight | 557.66 g/mol |
| Exact Mass | 557.29 |
| IUPAC Name | 3-[3-[(4-ethoxybenzoyl)amino]piperidin-1-yl]-5-[4-(pyrrolidine-1-carboximidoyl)anilino]-1,2,4-triazine-6-carboxamide |
| SMILES | [H]/N=C(/c1ccc(Nc2nc(N3CCCC(NC(=O)c4ccc(OCC)cc4)C3)nnc2C(N)=O)cc1)N1CCCC1 |
| InChI | InChI=1S/C29H35N9O3/c1-2-41-23-13-9-20(10-14-23)28(40)33-22-6-5-17-38(18-22)29-34-27(24(26(31)39)35-36-29)32-21-11-7-19(8-12-21)25(30)37-15-3-4-16-37/h7-14,22,30H,2-6,15-18H2,1H3,(H2,31,39)(H,33,40)(H,32,34,36)/b30-25- |
| InChIKey | QMPCZRYAQUSGAU-JVCXMKTPSA-N |
| XLogP | 2.93 |
| TPSA | 162.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.66 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|