C12H11F3O — CID 150898960
7-(2,2,2-trifluoroethoxy)-1,2-dihydronaphthalene (PubChem CID 150898960) has the molecular formula C12H11F3O and a molecular weight of 228.21 g/mol. Its IUPAC name is 7-(2,2,2-trifluoroethoxy)-1,2-dihydronaphthalene.
| Compound Name | 7-(2,2,2-trifluoroethoxy)-1,2-dihydronaphthalene |
|---|---|
| PubChem CID | 150898960 |
| Molecular Formula | C12H11F3O |
| Molecular Weight | 228.21 g/mol |
| Exact Mass | 228.08 |
| IUPAC Name | 7-(2,2,2-trifluoroethoxy)-1,2-dihydronaphthalene |
| SMILES | FC(F)(F)COc1ccc2c(c1)CCC=C2 |
| InChI | InChI=1S/C12H11F3O/c13-12(14,15)8-16-11-6-5-9-3-1-2-4-10(9)7-11/h1,3,5-7H,2,4,8H2 |
| InChIKey | KZPKKCJBUZXXAY-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.21 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |