About 4-(prop-2-ynylamino)cyclohexa-1,5-diene-1,4-diol
4-(prop-2-ynylamino)cyclohexa-1,5-diene-1,4-diol (PubChem CID 150900439) has the molecular formula C9H11NO2
and a molecular weight of 165.19 g/mol. Its IUPAC name is 4-(prop-2-ynylamino)cyclohexa-1,5-diene-1,4-diol.
Molecular Properties
| Compound Name | 4-(prop-2-ynylamino)cyclohexa-1,5-diene-1,4-diol |
| PubChem CID | 150900439 |
| Molecular Formula | C9H11NO2 |
| Molecular Weight | 165.19 g/mol |
| Exact Mass | 165.08 |
| IUPAC Name | 4-(prop-2-ynylamino)cyclohexa-1,5-diene-1,4-diol |
| SMILES | C#CCNC1(O)C=CC(O)=CC1 |
| InChI | InChI=1S/C9H11NO2/c1-2-7-10-9(12)5-3-8(11)4-6-9/h1,3-5,10-12H,6-7H2 |
| InChIKey | KZWYIHZDSOPYIX-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.19 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-(prop-2-ynylamino)cyclohexa-1,5-diene-1,4-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(prop-2-ynylamino)cyclohexa-1,5-diene-1,4-diol?
The IUPAC name of 4-(prop-2-ynylamino)cyclohexa-1,5-diene-1,4-diol (CID 150900439) is 4-(prop-2-ynylamino)cyclohexa-1,5-diene-1,4-diol.
What is the SMILES notation for 4-(prop-2-ynylamino)cyclohexa-1,5-diene-1,4-diol?
The canonical SMILES for 4-(prop-2-ynylamino)cyclohexa-1,5-diene-1,4-diol is C#CCNC1(O)C=CC(O)=CC1.
What is the InChIKey of 4-(prop-2-ynylamino)cyclohexa-1,5-diene-1,4-diol?
The InChIKey is KZWYIHZDSOPYIX-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11NO2/c1-2-7-10-9(12)5-3-8(11)4-6-9/h1,3-5,10-12H,6-7H2.
What are the key properties of 4-(prop-2-ynylamino)cyclohexa-1,5-diene-1,4-diol?
4-(prop-2-ynylamino)cyclohexa-1,5-diene-1,4-diol has a molecular weight of 165.19 g/mol, XLogP of 0.30, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(prop-2-ynylamino)cyclohexa-1,5-diene-1,4-diol is sourced from PubChem (CID 150900439), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).