C10H17NO — CID 151053684
1-(butylamino)cyclohexa-2,4-dien-1-ol (PubChem CID 151053684) has the molecular formula C10H17NO and a molecular weight of 167.25 g/mol. Its IUPAC name is 1-(butylamino)cyclohexa-2,4-dien-1-ol.
| Compound Name | 1-(butylamino)cyclohexa-2,4-dien-1-ol |
|---|---|
| PubChem CID | 151053684 |
| Molecular Formula | C10H17NO |
| Molecular Weight | 167.25 g/mol |
| Exact Mass | 167.13 |
| IUPAC Name | 1-(butylamino)cyclohexa-2,4-dien-1-ol |
| SMILES | CCCCNC1(O)C=CC=CC1 |
| InChI | InChI=1S/C10H17NO/c1-2-3-9-11-10(12)7-5-4-6-8-10/h4-7,11-12H,2-3,8-9H2,1H3 |
| InChIKey | MEQUQVMZKPOWLP-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.25 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|