C9H16N2O — CID 70668155
amino-[4-(ethylamino)cyclohexa-1,5-dien-1-yl]methanol (PubChem CID 70668155) has the molecular formula C9H16N2O and a molecular weight of 168.24 g/mol. Its IUPAC name is amino-[4-(ethylamino)cyclohexa-1,5-dien-1-yl]methanol.
| Compound Name | amino-[4-(ethylamino)cyclohexa-1,5-dien-1-yl]methanol |
|---|---|
| PubChem CID | 70668155 |
| Molecular Formula | C9H16N2O |
| Molecular Weight | 168.24 g/mol |
| Exact Mass | 168.13 |
| IUPAC Name | amino-[4-(ethylamino)cyclohexa-1,5-dien-1-yl]methanol |
| SMILES | CCNC1C=CC(C(N)O)=CC1 |
| InChI | InChI=1S/C9H16N2O/c1-2-11-8-5-3-7(4-6-8)9(10)12/h3-5,8-9,11-12H,2,6,10H2,1H3 |
| InChIKey | QHMWXCOYEGBVMZ-UHFFFAOYSA-N |
| XLogP | 0.13 |
| TPSA | 58.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.24 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|