C9H11NO2 — CID 151084962
4-(prop-1-ynylamino)cyclohexa-1,5-diene-1,4-diol (PubChem CID 151084962) has the molecular formula C9H11NO2 and a molecular weight of 165.19 g/mol. Its IUPAC name is 4-(prop-1-ynylamino)cyclohexa-1,5-diene-1,4-diol.
| Compound Name | 4-(prop-1-ynylamino)cyclohexa-1,5-diene-1,4-diol |
|---|---|
| PubChem CID | 151084962 |
| Molecular Formula | C9H11NO2 |
| Molecular Weight | 165.19 g/mol |
| Exact Mass | 165.08 |
| IUPAC Name | 4-(prop-1-ynylamino)cyclohexa-1,5-diene-1,4-diol |
| SMILES | CC#CNC1(O)C=CC(O)=CC1 |
| InChI | InChI=1S/C9H11NO2/c1-2-7-10-9(12)5-3-8(11)4-6-9/h3-5,10-12H,6H2,1H3 |
| InChIKey | MKXKEHDVMHIYKI-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.19 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|