C6H9NO2 — CID 151175551
(4S)-4-aminocyclohexa-1,5-diene-1,4-diol (PubChem CID 151175551) has the molecular formula C6H9NO2 and a molecular weight of 127.14 g/mol. Its IUPAC name is (4S)-4-aminocyclohexa-1,5-diene-1,4-diol.
| Compound Name | (4S)-4-aminocyclohexa-1,5-diene-1,4-diol |
|---|---|
| PubChem CID | 151175551 |
| Molecular Formula | C6H9NO2 |
| Molecular Weight | 127.14 g/mol |
| Exact Mass | 127.06 |
| IUPAC Name | (4S)-4-aminocyclohexa-1,5-diene-1,4-diol |
| SMILES | N[C@@]1(O)C=CC(O)=CC1 |
| InChI | InChI=1S/C6H9NO2/c7-6(9)3-1-5(8)2-4-6/h1-3,8-9H,4,7H2/t6-/m1/s1 |
| InChIKey | NDEQBSZXBZYKNS-ZCFIWIBFSA-N |
| XLogP | 0.04 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 127.14 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|