C18H21N3O3 — CID 150911210
ethyl 6-(4-carbamoylpiperidin-1-yl)quinoline-3-carboxylate (PubChem CID 150911210) has the molecular formula C18H21N3O3 and a molecular weight of 327.38 g/mol. Its IUPAC name is ethyl 6-(4-carbamoylpiperidin-1-yl)quinoline-3-carboxylate.
| Compound Name | ethyl 6-(4-carbamoylpiperidin-1-yl)quinoline-3-carboxylate |
|---|---|
| PubChem CID | 150911210 |
| Molecular Formula | C18H21N3O3 |
| Molecular Weight | 327.38 g/mol |
| Exact Mass | 327.16 |
| IUPAC Name | ethyl 6-(4-carbamoylpiperidin-1-yl)quinoline-3-carboxylate |
| SMILES | CCOC(=O)c1cnc2ccc(N3CCC(C(N)=O)CC3)cc2c1 |
| InChI | InChI=1S/C18H21N3O3/c1-2-24-18(23)14-9-13-10-15(3-4-16(13)20-11-14)21-7-5-12(6-8-21)17(19)22/h3-4,9-12H,2,5-8H2,1H3,(H2,19,22) |
| InChIKey | LCAKDUZUUJHFSP-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 85.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.38 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |