4-methyl-2-propan-2-yl-1,3-thiazole-5-carboxylic acid

C8H11NO2S — CID 15093930

IUPAC4-methyl-2-propan-2-yl-1,3-thiazole-5-carboxylic acid
SMILESCc1nc(C(C)C)sc1C(=O)O
InChIInChI=1S/C8H11NO2S/c1-4(2)7-9-5(3)6(12-7)8(10)11/h4H,1-3H3,(H,10,11)
InChIKeyMLCHZLUFNGBRSL-UHFFFAOYSA-N
MW185.25 g/mol
LogP2.27
Rot. Bonds2

About 4-methyl-2-propan-2-yl-1,3-thiazole-5-carboxylic acid

4-methyl-2-propan-2-yl-1,3-thiazole-5-carboxylic acid (PubChem CID 15093930) has the molecular formula C8H11NO2S and a molecular weight of 185.25 g/mol. Its IUPAC name is 4-methyl-2-propan-2-yl-1,3-thiazole-5-carboxylic acid.

Molecular Properties

Compound Name4-methyl-2-propan-2-yl-1,3-thiazole-5-carboxylic acid
PubChem CID15093930
Molecular FormulaC8H11NO2S
Molecular Weight185.25 g/mol
Exact Mass185.05
IUPAC Name4-methyl-2-propan-2-yl-1,3-thiazole-5-carboxylic acid
SMILESCc1nc(C(C)C)sc1C(=O)O
InChIInChI=1S/C8H11NO2S/c1-4(2)7-9-5(3)6(12-7)8(10)11/h4H,1-3H3,(H,10,11)
InChIKeyMLCHZLUFNGBRSL-UHFFFAOYSA-N
XLogP2.27
TPSA50.19 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms12
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500185.25
LogP ≤ 52.27
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 4-methyl-2-propan-2-yl-1,3-thiazole-5-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-methyl-2-propan-2-yl-1,3-thiazole-5-carboxylic acid?
The IUPAC name of 4-methyl-2-propan-2-yl-1,3-thiazole-5-carboxylic acid (CID 15093930) is 4-methyl-2-propan-2-yl-1,3-thiazole-5-carboxylic acid.
What is the SMILES notation for 4-methyl-2-propan-2-yl-1,3-thiazole-5-carboxylic acid?
The canonical SMILES for 4-methyl-2-propan-2-yl-1,3-thiazole-5-carboxylic acid is Cc1nc(C(C)C)sc1C(=O)O.
What is the InChIKey of 4-methyl-2-propan-2-yl-1,3-thiazole-5-carboxylic acid?
The InChIKey is MLCHZLUFNGBRSL-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11NO2S/c1-4(2)7-9-5(3)6(12-7)8(10)11/h4H,1-3H3,(H,10,11).
What are the key properties of 4-methyl-2-propan-2-yl-1,3-thiazole-5-carboxylic acid?
4-methyl-2-propan-2-yl-1,3-thiazole-5-carboxylic acid has a molecular weight of 185.25 g/mol, XLogP of 2.27, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-2-propan-2-yl-1,3-thiazole-5-carboxylic acid is sourced from PubChem (CID 15093930), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).