C19H22N6Se2 — CID 15094075
(1,7-diazido-6-phenylselanylheptan-2-yl)selanylbenzene (PubChem CID 15094075) has the molecular formula C19H22N6Se2 and a molecular weight of 492.35 g/mol. Its IUPAC name is (1,7-diazido-6-phenylselanylheptan-2-yl)selanylbenzene.
| Compound Name | (1,7-diazido-6-phenylselanylheptan-2-yl)selanylbenzene |
|---|---|
| PubChem CID | 15094075 |
| Molecular Formula | C19H22N6Se2 |
| Molecular Weight | 492.35 g/mol |
| Exact Mass | 494.02 |
| IUPAC Name | (1,7-diazido-6-phenylselanylheptan-2-yl)selanylbenzene |
| SMILES | [N-]=[N+]=NCC(CCCC(CN=[N+]=[N-])[Se]c1ccccc1)[Se]c1ccccc1 |
| InChI | InChI=1S/C19H22N6Se2/c20-24-22-14-18(26-16-8-3-1-4-9-16)12-7-13-19(15-23-25-21)27-17-10-5-2-6-11-17/h1-6,8-11,18-19H,7,12-15H2 |
| InChIKey | QTJOYFPUDJGZKW-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 97.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.35 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|