C24H51NO3 — CID 150947658
N,N-bis(2-methylpropyl)-4-(trimethoxymethyl)dodecan-1-amine (PubChem CID 150947658) has the molecular formula C24H51NO3 and a molecular weight of 401.68 g/mol. Its IUPAC name is N,N-bis(2-methylpropyl)-4-(trimethoxymethyl)dodecan-1-amine.
| Compound Name | N,N-bis(2-methylpropyl)-4-(trimethoxymethyl)dodecan-1-amine |
|---|---|
| PubChem CID | 150947658 |
| Molecular Formula | C24H51NO3 |
| Molecular Weight | 401.68 g/mol |
| Exact Mass | 401.39 |
| IUPAC Name | N,N-bis(2-methylpropyl)-4-(trimethoxymethyl)dodecan-1-amine |
| SMILES | CCCCCCCCC(CCCN(CC(C)C)CC(C)C)C(OC)(OC)OC |
| InChI | InChI=1S/C24H51NO3/c1-9-10-11-12-13-14-16-23(24(26-6,27-7)28-8)17-15-18-25(19-21(2)3)20-22(4)5/h21-23H,9-20H2,1-8H3 |
| InChIKey | LJKGFZUEBUWHIM-UHFFFAOYSA-N |
| XLogP | 6.34 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.68 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|