C24H35F2NO3 — CID 150959779
octan-3-yl N-[1-[4-(4,4-difluorocyclohexyl)oxyphenyl]cyclopropyl]carbamate (PubChem CID 150959779) has the molecular formula C24H35F2NO3 and a molecular weight of 423.54 g/mol. Its IUPAC name is octan-3-yl N-[1-[4-(4,4-difluorocyclohexyl)oxyphenyl]cyclopropyl]carbamate.
| Compound Name | octan-3-yl N-[1-[4-(4,4-difluorocyclohexyl)oxyphenyl]cyclopropyl]carbamate |
|---|---|
| PubChem CID | 150959779 |
| Molecular Formula | C24H35F2NO3 |
| Molecular Weight | 423.54 g/mol |
| Exact Mass | 423.26 |
| IUPAC Name | octan-3-yl N-[1-[4-(4,4-difluorocyclohexyl)oxyphenyl]cyclopropyl]carbamate |
| SMILES | CCCCCC(CC)OC(=O)NC1(c2ccc(OC3CCC(F)(F)CC3)cc2)CC1 |
| InChI | InChI=1S/C24H35F2NO3/c1-3-5-6-7-19(4-2)30-22(28)27-23(16-17-23)18-8-10-20(11-9-18)29-21-12-14-24(25,26)15-13-21/h8-11,19,21H,3-7,12-17H2,1-2H3,(H,27,28) |
| InChIKey | LLVVOWMHSBLKQB-UHFFFAOYSA-N |
| XLogP | 6.72 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.54 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|